C17H14F16P+ — CID 23123622
2,3,4,5,6,9-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphanium (PubChem CID 23123622) has the molecular formula C17H14F16P+ and a molecular weight of 553.24 g/mol. Its IUPAC name is 2,3,4,5,6,9-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphanium.
| Compound Name | 2,3,4,5,6,9-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphanium |
|---|---|
| PubChem CID | 23123622 |
| Molecular Formula | C17H14F16P+ |
| Molecular Weight | 553.24 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | 2,3,4,5,6,9-hexafluorononyl-(1,1,2,2,2-pentafluoroethyl)-(2,3,4,5,6-pentafluorophenyl)phosphanium |
| SMILES | FCCCC(F)C(F)C(F)C(F)C(F)C[PH+](c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F16P/c18-3-1-2-5(19)7(21)9(23)8(22)6(20)4-34(17(32,33)16(29,30)31)15-13(27)11(25)10(24)12(26)14(15)28/h5-9H,1-4H2/p+1 |
| InChIKey | YZOJQSLOGAEDLV-UHFFFAOYSA-O |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.24 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|