C16H21F8N — CID 23123661
1-fluoro-N-(fluoromethyl)-N-(1,1,2,2,3,3-hexafluorononyl)cyclohexa-2,4-dien-1-amine (PubChem CID 23123661) has the molecular formula C16H21F8N and a molecular weight of 379.34 g/mol. Its IUPAC name is 1-fluoro-N-(fluoromethyl)-N-(1,1,2,2,3,3-hexafluorononyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-(fluoromethyl)-N-(1,1,2,2,3,3-hexafluorononyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 23123661 |
| Molecular Formula | C16H21F8N |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-fluoro-N-(fluoromethyl)-N-(1,1,2,2,3,3-hexafluorononyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)N(CF)C1(F)C=CC=CC1 |
| InChI | InChI=1S/C16H21F8N/c1-2-3-4-8-11-14(19,20)15(21,22)16(23,24)25(12-17)13(18)9-6-5-7-10-13/h5-7,9H,2-4,8,10-12H2,1H3 |
| InChIKey | BFRQRHJQJVIQSB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|