C8H4Br2F5NS — CID 23123744
2,6-dibromo-4-(1,1,2,2,2-pentafluoroethylsulfanyl)aniline (PubChem CID 23123744) has the molecular formula C8H4Br2F5NS and a molecular weight of 400.99 g/mol. Its IUPAC name is 2,6-dibromo-4-(1,1,2,2,2-pentafluoroethylsulfanyl)aniline.
| Compound Name | 2,6-dibromo-4-(1,1,2,2,2-pentafluoroethylsulfanyl)aniline |
|---|---|
| PubChem CID | 23123744 |
| Molecular Formula | C8H4Br2F5NS |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 398.84 |
| IUPAC Name | 2,6-dibromo-4-(1,1,2,2,2-pentafluoroethylsulfanyl)aniline |
| SMILES | Nc1c(Br)cc(SC(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C8H4Br2F5NS/c9-4-1-3(2-5(10)6(4)16)17-8(14,15)7(11,12)13/h1-2H,16H2 |
| InChIKey | DZBBSFMOMRLWOL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|