C10H10F5NO2S — CID 23123767
2,6-dimethyl-4-(1,1,2,2,2-pentafluoroethylsulfonyl)aniline (PubChem CID 23123767) has the molecular formula C10H10F5NO2S and a molecular weight of 303.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,1,2,2,2-pentafluoroethylsulfonyl)aniline.
| Compound Name | 2,6-dimethyl-4-(1,1,2,2,2-pentafluoroethylsulfonyl)aniline |
|---|---|
| PubChem CID | 23123767 |
| Molecular Formula | C10H10F5NO2S |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2,6-dimethyl-4-(1,1,2,2,2-pentafluoroethylsulfonyl)aniline |
| SMILES | Cc1cc(S(=O)(=O)C(F)(F)C(F)(F)F)cc(C)c1N |
| InChI | InChI=1S/C10H10F5NO2S/c1-5-3-7(4-6(2)8(5)16)19(17,18)10(14,15)9(11,12)13/h3-4H,16H2,1-2H3 |
| InChIKey | RPEAPWPHTRUAGI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|