C9H4Br2F7NS — CID 23123770
2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)aniline (PubChem CID 23123770) has the molecular formula C9H4Br2F7NS and a molecular weight of 451.00 g/mol. Its IUPAC name is 2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)aniline.
| Compound Name | 2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 23123770 |
| Molecular Formula | C9H4Br2F7NS |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 448.83 |
| IUPAC Name | 2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)aniline |
| SMILES | Nc1c(Br)cc(SC(F)(C(F)(F)F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H4Br2F7NS/c10-4-1-3(2-5(11)6(4)19)20-7(12,8(13,14)15)9(16,17)18/h1-2H,19H2 |
| InChIKey | VFVCXVRPVRDCNB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|