C17H7Br2F7N2O4S — CID 23123814
N,2-dibromo-4-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)phenyl]-3-isocyanatobenzamide (PubChem CID 23123814) has the molecular formula C17H7Br2F7N2O4S and a molecular weight of 628.11 g/mol. Its IUPAC name is N,2-dibromo-4-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)phenyl]-3-isocyanatobenzamide.
| Compound Name | N,2-dibromo-4-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)phenyl]-3-isocyanatobenzamide |
|---|---|
| PubChem CID | 23123814 |
| Molecular Formula | C17H7Br2F7N2O4S |
| Molecular Weight | 628.11 g/mol |
| Exact Mass | 625.84 |
| IUPAC Name | N,2-dibromo-4-[2-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)phenyl]-3-isocyanatobenzamide |
| SMILES | O=C=Nc1c(-c2ccccc2S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc(C(=O)NBr)c1Br |
| InChI | InChI=1S/C17H7Br2F7N2O4S/c18-12-10(14(30)28-19)6-5-9(13(12)27-7-29)8-3-1-2-4-11(8)33(31,32)17(25,26)15(20,21)16(22,23)24/h1-6H,(H,28,30) |
| InChIKey | ZGDNLXGWBWJDPO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.11 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|