C12H10F9NOS — CID 23123874
2,6-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline (PubChem CID 23123874) has the molecular formula C12H10F9NOS and a molecular weight of 387.27 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline.
| Compound Name | 2,6-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline |
|---|---|
| PubChem CID | 23123874 |
| Molecular Formula | C12H10F9NOS |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2,6-dimethyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfinyl)aniline |
| SMILES | Cc1cc(S(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C)c1N |
| InChI | InChI=1S/C12H10F9NOS/c1-5-3-7(4-6(2)8(5)22)24(23)12(20,21)10(15,16)9(13,14)11(17,18)19/h3-4H,22H2,1-2H3 |
| InChIKey | SSBDJJNBKIEFTK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|