C29H30N2O7 — CID 23124623
4-(3-carboxypropyl)-8-[[4-(3-phenylpropoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 23124623) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is 4-(3-carboxypropyl)-8-[[4-(3-phenylpropoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(3-carboxypropyl)-8-[[4-(3-phenylpropoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 23124623 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 4-(3-carboxypropyl)-8-[[4-(3-phenylpropoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCN1CC(C(=O)O)Oc2c(NC(=O)c3ccc(OCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C29H30N2O7/c32-26(33)12-5-17-31-19-25(29(35)36)38-27-23(10-4-11-24(27)31)30-28(34)21-13-15-22(16-14-21)37-18-6-9-20-7-2-1-3-8-20/h1-4,7-8,10-11,13-16,25H,5-6,9,12,17-19H2,(H,30,34)(H,32,33)(H,35,36) |
| InChIKey | DOZMGZVZFNWUJS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|