C18H28N3O2PS — CID 2312464
(1-ethenyl-4,5,6,7-tetrahydroindol-2-yl)-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane (PubChem CID 2312464) has the molecular formula C18H28N3O2PS and a molecular weight of 381.48 g/mol. Its IUPAC name is (1-ethenyl-4,5,6,7-tetrahydroindol-2-yl)-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane.
| Compound Name | (1-ethenyl-4,5,6,7-tetrahydroindol-2-yl)-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 2312464 |
| Molecular Formula | C18H28N3O2PS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1-ethenyl-4,5,6,7-tetrahydroindol-2-yl)-dimorpholin-4-yl-sulfanylidene-lambda5-phosphane |
| SMILES | C=Cn1c(P(=S)(N2CCOCC2)N2CCOCC2)cc2c1CCCC2 |
| InChI | InChI=1S/C18H28N3O2PS/c1-2-21-17-6-4-3-5-16(17)15-18(21)24(25,19-7-11-22-12-8-19)20-9-13-23-14-10-20/h2,15H,1,3-14H2 |
| InChIKey | NHNFJLFELKERTQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|