C31H32N2O8 — CID 23124672
4-(4-carboxybutanoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 23124672) has the molecular formula C31H32N2O8 and a molecular weight of 560.60 g/mol. Its IUPAC name is 4-(4-carboxybutanoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-(4-carboxybutanoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 23124672 |
| Molecular Formula | C31H32N2O8 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 4-(4-carboxybutanoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)CCCC(=O)N1CC(C(=O)O)Oc2c(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H32N2O8/c34-27(13-7-14-28(35)36)33-20-26(31(38)39)41-29-24(11-6-12-25(29)33)32-30(37)22-15-17-23(18-16-22)40-19-5-4-10-21-8-2-1-3-9-21/h1-3,6,8-9,11-12,15-18,26H,4-5,7,10,13-14,19-20H2,(H,32,37)(H,35,36)(H,38,39) |
| InChIKey | WJAVSSKFTCSRBJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|