About 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate
2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate (PubChem CID 23125738) has the molecular formula C16H16N3O5-
and a molecular weight of 330.32 g/mol. Its IUPAC name is 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate.
Molecular Properties
| Compound Name | 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate |
| PubChem CID | 23125738 |
| Molecular Formula | C16H16N3O5- |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate |
| SMILES | COc1cc(Nc2nc(C)cc(C)c2[N+](=O)[O-])ccc1CC(=O)[O-] |
| InChI | InChI=1S/C16H17N3O5/c1-9-6-10(2)17-16(15(9)19(22)23)18-12-5-4-11(7-14(20)21)13(8-12)24-3/h4-6,8H,7H2,1-3H3,(H,17,18)(H,20,21)/p-1 |
| InChIKey | JZABDFACKOHBSC-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate?
The IUPAC name of 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate (CID 23125738) is 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate.
What is the SMILES notation for 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate?
The canonical SMILES for 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate is COc1cc(Nc2nc(C)cc(C)c2[N+](=O)[O-])ccc1CC(=O)[O-].
What is the InChIKey of 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate?
The InChIKey is JZABDFACKOHBSC-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H17N3O5/c1-9-6-10(2)17-16(15(9)19(22)23)18-12-5-4-11(7-14(20)21)13(8-12)24-3/h4-6,8H,7H2,1-3H3,(H,17,18)(H,20,21)/p-1.
What are the key properties of 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate?
2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate has a molecular weight of 330.32 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(4,6-dimethyl-3-nitro-2-pyridinyl)amino]-2-methoxyphenyl]acetate is sourced from PubChem (CID 23125738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).