C17H8Cl3N3O2S — CID 2312673
6-chloro-3-[5-(2,4-dichloroanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one (PubChem CID 2312673) has the molecular formula C17H8Cl3N3O2S and a molecular weight of 424.70 g/mol. Its IUPAC name is 6-chloro-3-[5-(2,4-dichloroanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one.
| Compound Name | 6-chloro-3-[5-(2,4-dichloroanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 2312673 |
| Molecular Formula | C17H8Cl3N3O2S |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 6-chloro-3-[5-(2,4-dichloroanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
| SMILES | O=c1oc2ccc(Cl)cc2cc1-c1nnc(Nc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C17H8Cl3N3O2S/c18-9-2-4-14-8(5-9)6-11(16(24)25-14)15-22-23-17(26-15)21-13-3-1-10(19)7-12(13)20/h1-7H,(H,21,23) |
| InChIKey | BOHHRLSIRYDAAE-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|