C9H13N3 — CID 23126789
3-diazo-N,N,2-trimethylcyclohexa-1,5-dien-1-amine (PubChem CID 23126789) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-diazo-N,N,2-trimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 3-diazo-N,N,2-trimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 23126789 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-diazo-N,N,2-trimethylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1=C(N(C)C)C=CCC1=[N+]=[N-] |
| InChI | InChI=1S/C9H13N3/c1-7-8(11-10)5-4-6-9(7)12(2)3/h4,6H,5H2,1-3H3 |
| InChIKey | DAQGZMLJWKOGEA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|