C14H16N2O3S — CID 2312770
propan-2-yl 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]acetate (PubChem CID 2312770) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is propan-2-yl 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2312770 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | propan-2-yl 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]acetate |
| SMILES | CC(=O)c1cc(C#N)c(SCC(=O)OC(C)C)nc1C |
| InChI | InChI=1S/C14H16N2O3S/c1-8(2)19-13(18)7-20-14-11(6-15)5-12(10(4)17)9(3)16-14/h5,8H,7H2,1-4H3 |
| InChIKey | RJJSVZQAAWOENW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |