C10H11N3O — CID 2312916
N-methoxy-1-(2-methylimidazo[1,2-a]pyridin-3-yl)methanimine (PubChem CID 2312916) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-methoxy-1-(2-methylimidazo[1,2-a]pyridin-3-yl)methanimine.
| Compound Name | N-methoxy-1-(2-methylimidazo[1,2-a]pyridin-3-yl)methanimine |
|---|---|
| PubChem CID | 2312916 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-methoxy-1-(2-methylimidazo[1,2-a]pyridin-3-yl)methanimine |
| SMILES | CON=Cc1c(C)nc2ccccn12 |
| InChI | InChI=1S/C10H11N3O/c1-8-9(7-11-14-2)13-6-4-3-5-10(13)12-8/h3-7H,1-2H3 |
| InChIKey | QLPQYTUNXUXRJR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|