C32H39N3O3 — CID 23129946
N-[1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-6-hydroxynaphthalene-2-carboxamide (PubChem CID 23129946) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-6-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-6-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 23129946 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-[1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-6-hydroxynaphthalene-2-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C32H39N3O3/c1-3-5-9-17-35(18-10-6-4-2)32(38)30(21-26-22-33-29-12-8-7-11-28(26)29)34-31(37)25-14-13-24-20-27(36)16-15-23(24)19-25/h7-8,11-16,19-20,22,30,33,36H,3-6,9-10,17-18,21H2,1-2H3,(H,34,37) |
| InChIKey | OCJWTEOWJCRLKQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|