About 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol
2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol (PubChem CID 23130077) has the molecular formula C15H23F3O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol |
| PubChem CID | 23130077 |
| Molecular Formula | C15H23F3O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol |
| SMILES | CC(C)(C)C1=CC(C(C)(C)C)(C(F)(F)F)C=CC1O |
| InChI | InChI=1S/C15H23F3O/c1-12(2,3)10-9-14(13(4,5)6,15(16,17)18)8-7-11(10)19/h7-9,11,19H,1-6H3 |
| InChIKey | YJPFYBUUTXUMEI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol?
The IUPAC name of 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol (CID 23130077) is 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol.
What is the SMILES notation for 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol?
The canonical SMILES for 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol is CC(C)(C)C1=CC(C(C)(C)C)(C(F)(F)F)C=CC1O.
What is the InChIKey of 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol?
The InChIKey is YJPFYBUUTXUMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F3O/c1-12(2,3)10-9-14(13(4,5)6,15(16,17)18)8-7-11(10)19/h7-9,11,19H,1-6H3.
What are the key properties of 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol?
2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol has a molecular weight of 276.34 g/mol, XLogP of 4.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-4-(trifluoromethyl)cyclohexa-2,5-dien-1-ol is sourced from PubChem (CID 23130077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).