About 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one
5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one (PubChem CID 23130082) has the molecular formula C17H27F3O2Si
and a molecular weight of 348.48 g/mol. Its IUPAC name is 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 23130082 |
| Molecular Formula | C17H27F3O2Si |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC[Si](CC)(CC)OC1(C(F)(F)F)C(=O)C=CC=C1C(C)(C)C |
| InChI | InChI=1S/C17H27F3O2Si/c1-7-23(8-2,9-3)22-16(17(18,19)20)13(15(4,5)6)11-10-12-14(16)21/h10-12H,7-9H2,1-6H3 |
| InChIKey | RIRVLPMPMLAUPL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one (CID 23130082) is 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one is CC[Si](CC)(CC)OC1(C(F)(F)F)C(=O)C=CC=C1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
The InChIKey is RIRVLPMPMLAUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27F3O2Si/c1-7-23(8-2,9-3)22-16(17(18,19)20)13(15(4,5)6)11-10-12-14(16)21/h10-12H,7-9H2,1-6H3.
What are the key properties of 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one?
5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one has a molecular weight of 348.48 g/mol, XLogP of 5.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-6-triethylsilyloxy-6-(trifluoromethyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 23130082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).