About 6-aminothieno[2,3-b]pyridine-5-carbonitrile
6-aminothieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 23130750) has the molecular formula C8H5N3S
and a molecular weight of 175.22 g/mol. Its IUPAC name is 6-aminothieno[2,3-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-aminothieno[2,3-b]pyridine-5-carbonitrile |
| PubChem CID | 23130750 |
| Molecular Formula | C8H5N3S |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 6-aminothieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cc2ccsc2nc1N |
| InChI | InChI=1S/C8H5N3S/c9-4-6-3-5-1-2-12-8(5)11-7(6)10/h1-3H,(H2,10,11) |
| InChIKey | CLIOHQNLWYOLCH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-aminothieno[2,3-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminothieno[2,3-b]pyridine-5-carbonitrile?
The IUPAC name of 6-aminothieno[2,3-b]pyridine-5-carbonitrile (CID 23130750) is 6-aminothieno[2,3-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-aminothieno[2,3-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-aminothieno[2,3-b]pyridine-5-carbonitrile is N#Cc1cc2ccsc2nc1N.
What is the InChIKey of 6-aminothieno[2,3-b]pyridine-5-carbonitrile?
The InChIKey is CLIOHQNLWYOLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S/c9-4-6-3-5-1-2-12-8(5)11-7(6)10/h1-3H,(H2,10,11).
What are the key properties of 6-aminothieno[2,3-b]pyridine-5-carbonitrile?
6-aminothieno[2,3-b]pyridine-5-carbonitrile has a molecular weight of 175.22 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminothieno[2,3-b]pyridine-5-carbonitrile is sourced from PubChem (CID 23130750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).