About 4-ethylpyridin-3-amine
4-ethylpyridin-3-amine (PubChem CID 23131401) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-ethylpyridin-3-amine.
Molecular Properties
| Compound Name | 4-ethylpyridin-3-amine |
| PubChem CID | 23131401 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-ethylpyridin-3-amine |
| SMILES | CCc1ccncc1N |
| InChI | InChI=1S/C7H10N2/c1-2-6-3-4-9-5-7(6)8/h3-5H,2,8H2,1H3 |
| InChIKey | GPGQIDCPGHSCGP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpyridin-3-amine?
The IUPAC name of 4-ethylpyridin-3-amine (CID 23131401) is 4-ethylpyridin-3-amine.
What is the SMILES notation for 4-ethylpyridin-3-amine?
The canonical SMILES for 4-ethylpyridin-3-amine is CCc1ccncc1N.
What is the InChIKey of 4-ethylpyridin-3-amine?
The InChIKey is GPGQIDCPGHSCGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-2-6-3-4-9-5-7(6)8/h3-5H,2,8H2,1H3.
What are the key properties of 4-ethylpyridin-3-amine?
4-ethylpyridin-3-amine has a molecular weight of 122.17 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpyridin-3-amine is sourced from PubChem (CID 23131401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).