About 3-ethylanthracen-1-amine
3-ethylanthracen-1-amine (PubChem CID 23131439) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-ethylanthracen-1-amine.
Molecular Properties
| Compound Name | 3-ethylanthracen-1-amine |
| PubChem CID | 23131439 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-ethylanthracen-1-amine |
| SMILES | CCc1cc(N)c2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C16H15N/c1-2-11-7-14-9-12-5-3-4-6-13(12)10-15(14)16(17)8-11/h3-10H,2,17H2,1H3 |
| InChIKey | LQMPLBJICITXCR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylanthracen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylanthracen-1-amine?
The IUPAC name of 3-ethylanthracen-1-amine (CID 23131439) is 3-ethylanthracen-1-amine.
What is the SMILES notation for 3-ethylanthracen-1-amine?
The canonical SMILES for 3-ethylanthracen-1-amine is CCc1cc(N)c2cc3ccccc3cc2c1.
What is the InChIKey of 3-ethylanthracen-1-amine?
The InChIKey is LQMPLBJICITXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-2-11-7-14-9-12-5-3-4-6-13(12)10-15(14)16(17)8-11/h3-10H,2,17H2,1H3.
What are the key properties of 3-ethylanthracen-1-amine?
3-ethylanthracen-1-amine has a molecular weight of 221.30 g/mol, XLogP of 4.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylanthracen-1-amine is sourced from PubChem (CID 23131439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).