About 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol
1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol (PubChem CID 23131631) has the molecular formula C15H13ClF3NO
and a molecular weight of 315.72 g/mol. Its IUPAC name is 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol |
| PubChem CID | 23131631 |
| Molecular Formula | C15H13ClF3NO |
| Molecular Weight | 315.72 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol |
| SMILES | Cc1cc(C(O)(c2ccc(Cl)cc2)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C15H13ClF3NO/c1-9-8-11(4-7-13(9)20)14(21,15(17,18)19)10-2-5-12(16)6-3-10/h2-8,21H,20H2,1H3 |
| InChIKey | LYLXJUXYDLNURQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol?
The IUPAC name of 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol (CID 23131631) is 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol?
The canonical SMILES for 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol is Cc1cc(C(O)(c2ccc(Cl)cc2)C(F)(F)F)ccc1N.
What is the InChIKey of 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol?
The InChIKey is LYLXJUXYDLNURQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF3NO/c1-9-8-11(4-7-13(9)20)14(21,15(17,18)19)10-2-5-12(16)6-3-10/h2-8,21H,20H2,1H3.
What are the key properties of 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol?
1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol has a molecular weight of 315.72 g/mol, XLogP of 4.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3-methylphenyl)-1-(4-chlorophenyl)-2,2,2-trifluoroethanol is sourced from PubChem (CID 23131631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).