About 1-methyl-3-propylpyrrole
1-methyl-3-propylpyrrole (PubChem CID 23131843) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 1-methyl-3-propylpyrrole.
Molecular Properties
| Compound Name | 1-methyl-3-propylpyrrole |
| PubChem CID | 23131843 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 1-methyl-3-propylpyrrole |
| SMILES | CCCc1ccn(C)c1 |
| InChI | InChI=1S/C8H13N/c1-3-4-8-5-6-9(2)7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | QTGQKVLMZFFGHA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-propylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propylpyrrole?
The IUPAC name of 1-methyl-3-propylpyrrole (CID 23131843) is 1-methyl-3-propylpyrrole.
What is the SMILES notation for 1-methyl-3-propylpyrrole?
The canonical SMILES for 1-methyl-3-propylpyrrole is CCCc1ccn(C)c1.
What is the InChIKey of 1-methyl-3-propylpyrrole?
The InChIKey is QTGQKVLMZFFGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-3-4-8-5-6-9(2)7-8/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-methyl-3-propylpyrrole?
1-methyl-3-propylpyrrole has a molecular weight of 123.20 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propylpyrrole is sourced from PubChem (CID 23131843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).