About 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride
3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride (PubChem CID 23132617) has the molecular formula C10H5ClN2O4S
and a molecular weight of 284.68 g/mol. Its IUPAC name is 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride |
| PubChem CID | 23132617 |
| Molecular Formula | C10H5ClN2O4S |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride |
| SMILES | [N-]=[N+]=C1C(=O)c2ccccc2C(=O)C1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H5ClN2O4S/c11-18(16,17)10-7(13-12)8(14)5-3-1-2-4-6(5)9(10)15/h1-4,10H |
| InChIKey | NAOAMSZZEPAPNP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride?
The IUPAC name of 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride (CID 23132617) is 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride.
What is the SMILES notation for 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride?
The canonical SMILES for 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride is [N-]=[N+]=C1C(=O)c2ccccc2C(=O)C1S(=O)(=O)Cl.
What is the InChIKey of 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride?
The InChIKey is NAOAMSZZEPAPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClN2O4S/c11-18(16,17)10-7(13-12)8(14)5-3-1-2-4-6(5)9(10)15/h1-4,10H.
What are the key properties of 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride?
3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride has a molecular weight of 284.68 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazo-1,4-dioxonaphthalene-2-sulfonyl chloride is sourced from PubChem (CID 23132617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).