About bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate
bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate (PubChem CID 23132909) has the molecular formula C25H19F3O5S2
and a molecular weight of 520.55 g/mol. Its IUPAC name is bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 23132909 |
| Molecular Formula | C25H19F3O5S2 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(C(F)(F)F)cc1.Oc1ccc([S+](c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14O2S.C7H5F3O3S/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-13H,(H-,19,20);1-4H,(H,11,12,13) |
| InChIKey | BORKEJHVMLSIOW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate (CID 23132909) is bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate is O=S(=O)([O-])c1ccc(C(F)(F)F)cc1.Oc1ccc([S+](c2ccccc2)c2ccc(O)cc2)cc1.
What is the InChIKey of bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate?
The InChIKey is BORKEJHVMLSIOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2S.C7H5F3O3S/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18;8-7(9,10)5-1-3-6(4-2-5)14(11,12)13/h1-13H,(H-,19,20);1-4H,(H,11,12,13).
What are the key properties of bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate?
bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate has a molecular weight of 520.55 g/mol, XLogP of 5.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxyphenyl)-phenylsulfanium;4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 23132909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).