C19H20ClN5O5S — CID 23133566
5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-pyridin-4-ylimidazolidine-2,4-dione (PubChem CID 23133566) has the molecular formula C19H20ClN5O5S and a molecular weight of 465.92 g/mol. Its IUPAC name is 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-pyridin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-pyridin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 23133566 |
| Molecular Formula | C19H20ClN5O5S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 5-[[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonylmethyl]-5-pyridin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CS(=O)(=O)N2CCC(Oc3ccc(Cl)cn3)CC2)(c2ccncc2)N1 |
| InChI | InChI=1S/C19H20ClN5O5S/c20-14-1-2-16(22-11-14)30-15-5-9-25(10-6-15)31(28,29)12-19(13-3-7-21-8-4-13)17(26)23-18(27)24-19/h1-4,7-8,11,15H,5-6,9-10,12H2,(H2,23,24,26,27) |
| InChIKey | CUMKILVWSBVBNL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|