C17H18O4 — CID 23134397
3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]benzoic acid (PubChem CID 23134397) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]benzoic acid.
| Compound Name | 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]benzoic acid |
|---|---|
| PubChem CID | 23134397 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]benzoic acid |
| SMILES | Cc1cc(-c2cccc(C(=O)O)c2)cc(C)c1OCCO |
| InChI | InChI=1S/C17H18O4/c1-11-8-15(9-12(2)16(11)21-7-6-18)13-4-3-5-14(10-13)17(19)20/h3-5,8-10,18H,6-7H2,1-2H3,(H,19,20) |
| InChIKey | BEYQLVXDMRBKPX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |