C18H24BN3O5 — CID 23134615
4-nitro-2-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 23134615) has the molecular formula C18H24BN3O5 and a molecular weight of 373.22 g/mol. Its IUPAC name is 4-nitro-2-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-nitro-2-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 23134615 |
| Molecular Formula | C18H24BN3O5 |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-nitro-2-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CC1(C)OB(c2ccc3nn(C4CCCCO4)cc3c2[N+](=O)[O-])OC1(C)C |
| InChI | InChI=1S/C18H24BN3O5/c1-17(2)18(3,4)27-19(26-17)13-8-9-14-12(16(13)22(23)24)11-21(20-14)15-7-5-6-10-25-15/h8-9,11,15H,5-7,10H2,1-4H3 |
| InChIKey | IECXFXKKTHQBSN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|