C19H21F6N3O3 — CID 23134694
5-[[4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-yl]amino]pentan-1-ol (PubChem CID 23134694) has the molecular formula C19H21F6N3O3 and a molecular weight of 453.38 g/mol. Its IUPAC name is 5-[[4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 23134694 |
| Molecular Formula | C19H21F6N3O3 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 5-[[4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1nccc(-c2cc(OCC(F)(F)F)ccc2OCC(F)(F)F)n1 |
| InChI | InChI=1S/C19H21F6N3O3/c20-18(21,22)11-30-13-4-5-16(31-12-19(23,24)25)14(10-13)15-6-8-27-17(28-15)26-7-2-1-3-9-29/h4-6,8,10,29H,1-3,7,9,11-12H2,(H,26,27,28) |
| InChIKey | YQNYMRLFVWRWQZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|