C14H11F6N3O2 — CID 23134743
4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 23134743) has the molecular formula C14H11F6N3O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 23134743 |
| Molecular Formula | C14H11F6N3O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2cc(OCC(F)(F)F)ccc2OCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H11F6N3O2/c15-13(16,17)6-24-8-1-2-11(25-7-14(18,19)20)9(5-8)10-3-4-22-12(21)23-10/h1-5H,6-7H2,(H2,21,22,23) |
| InChIKey | WZEUFISNSRAVLC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |