About 2H-benzotriazole;morpholine
2H-benzotriazole;morpholine (PubChem CID 23134831) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2H-benzotriazole;morpholine.
Molecular Properties
| Compound Name | 2H-benzotriazole;morpholine |
| PubChem CID | 23134831 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2H-benzotriazole;morpholine |
| SMILES | C1COCCN1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C4H9NO/c1-2-4-6-5(3-1)7-9-8-6;1-3-6-4-2-5-1/h1-4H,(H,7,8,9);5H,1-4H2 |
| InChIKey | OZIKLUQNNGASRY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-benzotriazole;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;morpholine?
The IUPAC name of 2H-benzotriazole;morpholine (CID 23134831) is 2H-benzotriazole;morpholine.
What is the SMILES notation for 2H-benzotriazole;morpholine?
The canonical SMILES for 2H-benzotriazole;morpholine is C1COCCN1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;morpholine?
The InChIKey is OZIKLUQNNGASRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C4H9NO/c1-2-4-6-5(3-1)7-9-8-6;1-3-6-4-2-5-1/h1-4H,(H,7,8,9);5H,1-4H2.
What are the key properties of 2H-benzotriazole;morpholine?
2H-benzotriazole;morpholine has a molecular weight of 206.25 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;morpholine is sourced from PubChem (CID 23134831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).