About 2-oxa-5,9-diazaspiro[6.6]tridecane
2-oxa-5,9-diazaspiro[6.6]tridecane (PubChem CID 23135256) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-oxa-5,9-diazaspiro[6.6]tridecane.
Molecular Properties
| Compound Name | 2-oxa-5,9-diazaspiro[6.6]tridecane |
| PubChem CID | 23135256 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-oxa-5,9-diazaspiro[6.6]tridecane |
| SMILES | C1CCC2(CNC1)CNCCOC2 |
| InChI | InChI=1S/C10H20N2O/c1-2-4-11-7-10(3-1)8-12-5-6-13-9-10/h11-12H,1-9H2 |
| InChIKey | XMTZUKDXDWERRC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxa-5,9-diazaspiro[6.6]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxa-5,9-diazaspiro[6.6]tridecane?
The IUPAC name of 2-oxa-5,9-diazaspiro[6.6]tridecane (CID 23135256) is 2-oxa-5,9-diazaspiro[6.6]tridecane.
What is the SMILES notation for 2-oxa-5,9-diazaspiro[6.6]tridecane?
The canonical SMILES for 2-oxa-5,9-diazaspiro[6.6]tridecane is C1CCC2(CNC1)CNCCOC2.
What is the InChIKey of 2-oxa-5,9-diazaspiro[6.6]tridecane?
The InChIKey is XMTZUKDXDWERRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-2-4-11-7-10(3-1)8-12-5-6-13-9-10/h11-12H,1-9H2.
What are the key properties of 2-oxa-5,9-diazaspiro[6.6]tridecane?
2-oxa-5,9-diazaspiro[6.6]tridecane has a molecular weight of 184.28 g/mol, XLogP of 0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxa-5,9-diazaspiro[6.6]tridecane is sourced from PubChem (CID 23135256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).