About 8-thia-3,11-diazaspiro[5.6]dodecane
8-thia-3,11-diazaspiro[5.6]dodecane (PubChem CID 23135364) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is 8-thia-3,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 8-thia-3,11-diazaspiro[5.6]dodecane |
| PubChem CID | 23135364 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 8-thia-3,11-diazaspiro[5.6]dodecane |
| SMILES | C1CC2(CCN1)CNCCSC2 |
| InChI | InChI=1S/C9H18N2S/c1-3-10-4-2-9(1)7-11-5-6-12-8-9/h10-11H,1-8H2 |
| InChIKey | JUFXTNKXZIZRPX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-thia-3,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-thia-3,11-diazaspiro[5.6]dodecane?
The IUPAC name of 8-thia-3,11-diazaspiro[5.6]dodecane (CID 23135364) is 8-thia-3,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 8-thia-3,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 8-thia-3,11-diazaspiro[5.6]dodecane is C1CC2(CCN1)CNCCSC2.
What is the InChIKey of 8-thia-3,11-diazaspiro[5.6]dodecane?
The InChIKey is JUFXTNKXZIZRPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-3-10-4-2-9(1)7-11-5-6-12-8-9/h10-11H,1-8H2.
What are the key properties of 8-thia-3,11-diazaspiro[5.6]dodecane?
8-thia-3,11-diazaspiro[5.6]dodecane has a molecular weight of 186.32 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-thia-3,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 23135364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).