About tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate
tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23136028) has the molecular formula C30H32O2Si
and a molecular weight of 452.67 g/mol. Its IUPAC name is tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 23136028 |
| Molecular Formula | C30H32O2Si |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C(=O)O[Si](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)CC2C=CC1C2 |
| InChI | InChI=1S/C30H32O2Si/c1-30(20-27-17-18-28(30)19-27)29(31)32-33(21-24-11-5-2-6-12-24,22-25-13-7-3-8-14-25)23-26-15-9-4-10-16-26/h2-18,27-28H,19-23H2,1H3 |
| InChIKey | NUKVWCHUCZBRIM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 23136028) is tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate is CC1(C(=O)O[Si](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)CC2C=CC1C2.
What is the InChIKey of tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is NUKVWCHUCZBRIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32O2Si/c1-30(20-27-17-18-28(30)19-27)29(31)32-33(21-24-11-5-2-6-12-24,22-25-13-7-3-8-14-25)23-26-15-9-4-10-16-26/h2-18,27-28H,19-23H2,1H3.
What are the key properties of tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 452.67 g/mol, XLogP of 6.42, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tribenzylsilyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 23136028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).