About [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate
[butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 23136037) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 23136037 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCCC[Si](C)(C)OC(=O)C1(CC)CC2C=CC1C2 |
| InChI | InChI=1S/C16H28O2Si/c1-5-7-10-19(3,4)18-15(17)16(6-2)12-13-8-9-14(16)11-13/h8-9,13-14H,5-7,10-12H2,1-4H3 |
| InChIKey | CVRIAGQLLMXVAP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 23136037) is [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate is CCCC[Si](C)(C)OC(=O)C1(CC)CC2C=CC1C2.
What is the InChIKey of [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is CVRIAGQLLMXVAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2Si/c1-5-7-10-19(3,4)18-15(17)16(6-2)12-13-8-9-14(16)11-13/h8-9,13-14H,5-7,10-12H2,1-4H3.
What are the key properties of [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate?
[butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 280.48 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(dimethyl)silyl] 2-ethylbicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 23136037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).