C8H13N3O3 — CID 23136080
3-(2,6-dioxopiperidin-1-yl)propanehydrazide (PubChem CID 23136080) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(2,6-dioxopiperidin-1-yl)propanehydrazide.
| Compound Name | 3-(2,6-dioxopiperidin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 23136080 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3-(2,6-dioxopiperidin-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1C(=O)CCCC1=O |
| InChI | InChI=1S/C8H13N3O3/c9-10-6(12)4-5-11-7(13)2-1-3-8(11)14/h1-5,9H2,(H,10,12) |
| InChIKey | ZKMONPZTLUWXRK-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|