C10H25N7O2 — CID 23136119
3-[2-[2-aminoethyl-(3-hydrazinyl-3-oxopropyl)amino]ethylamino]propanehydrazide (PubChem CID 23136119) has the molecular formula C10H25N7O2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-[2-[2-aminoethyl-(3-hydrazinyl-3-oxopropyl)amino]ethylamino]propanehydrazide.
| Compound Name | 3-[2-[2-aminoethyl-(3-hydrazinyl-3-oxopropyl)amino]ethylamino]propanehydrazide |
|---|---|
| PubChem CID | 23136119 |
| Molecular Formula | C10H25N7O2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 3-[2-[2-aminoethyl-(3-hydrazinyl-3-oxopropyl)amino]ethylamino]propanehydrazide |
| SMILES | NCCN(CCNCCC(=O)NN)CCC(=O)NN |
| InChI | InChI=1S/C10H25N7O2/c11-3-7-17(6-2-10(19)16-13)8-5-14-4-1-9(18)15-12/h14H,1-8,11-13H2,(H,15,18)(H,16,19) |
| InChIKey | OGWSYCUJEBXUJV-UHFFFAOYSA-N |
| XLogP | -3.40 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|