About 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide
4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide (PubChem CID 2313643) has the molecular formula C20H20NO2PS
and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide.
Molecular Properties
| Compound Name | 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide |
| PubChem CID | 2313643 |
| Molecular Formula | C20H20NO2PS |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide |
| SMILES | O=P1(N2CCOCC2)C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C20H20NO2PS/c22-24(21-11-13-23-14-12-21)15-19(17-7-3-1-4-8-17)25-20(16-24)18-9-5-2-6-10-18/h1-10,15-16H,11-14H2 |
| InChIKey | OSGQUNULYPGAQH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide?
The IUPAC name of 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide (CID 2313643) is 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide.
What is the SMILES notation for 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide?
The canonical SMILES for 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide is O=P1(N2CCOCC2)C=C(c2ccccc2)SC(c2ccccc2)=C1.
What is the InChIKey of 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide?
The InChIKey is OSGQUNULYPGAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20NO2PS/c22-24(21-11-13-23-14-12-21)15-19(17-7-3-1-4-8-17)25-20(16-24)18-9-5-2-6-10-18/h1-10,15-16H,11-14H2.
What are the key properties of 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide?
4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide has a molecular weight of 369.43 g/mol, XLogP of 5.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-yl-2,6-diphenyl-1,4lambda5-thiaphosphinine 4-oxide is sourced from PubChem (CID 2313643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).