About ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate
ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate (PubChem CID 23136476) has the molecular formula C23H21F2NO4
and a molecular weight of 413.42 g/mol. Its IUPAC name is ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate |
| PubChem CID | 23136476 |
| Molecular Formula | C23H21F2NO4 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(F)c(OCc2cccc(Oc3ccccn3)c2)c(F)c1 |
| InChI | InChI=1S/C23H21F2NO4/c1-2-28-22(27)10-9-16-13-19(24)23(20(25)14-16)29-15-17-6-5-7-18(12-17)30-21-8-3-4-11-26-21/h3-8,11-14H,2,9-10,15H2,1H3 |
| InChIKey | ASOPHXFKFXZAQG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate?
The IUPAC name of ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate (CID 23136476) is ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate.
What is the SMILES notation for ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate?
The canonical SMILES for ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate is CCOC(=O)CCc1cc(F)c(OCc2cccc(Oc3ccccn3)c2)c(F)c1.
What is the InChIKey of ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate?
The InChIKey is ASOPHXFKFXZAQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2NO4/c1-2-28-22(27)10-9-16-13-19(24)23(20(25)14-16)29-15-17-6-5-7-18(12-17)30-21-8-3-4-11-26-21/h3-8,11-14H,2,9-10,15H2,1H3.
What are the key properties of ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate?
ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate has a molecular weight of 413.42 g/mol, XLogP of 5.23, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3,5-difluoro-4-[(3-pyridin-2-yloxyphenyl)methoxy]phenyl]propanoate is sourced from PubChem (CID 23136476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).