About 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid
3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid (PubChem CID 23136500) has the molecular formula C20H21F2NO4
and a molecular weight of 377.39 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid |
| PubChem CID | 23136500 |
| Molecular Formula | C20H21F2NO4 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(F)c(OCc2ccccc2N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C20H21F2NO4/c21-16-11-14(5-6-19(24)25)12-17(22)20(16)27-13-15-3-1-2-4-18(15)23-7-9-26-10-8-23/h1-4,11-12H,5-10,13H2,(H,24,25) |
| InChIKey | MJQKISMVUPFHTL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid?
The IUPAC name of 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid (CID 23136500) is 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid is O=C(O)CCc1cc(F)c(OCc2ccccc2N2CCOCC2)c(F)c1.
What is the InChIKey of 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid?
The InChIKey is MJQKISMVUPFHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2NO4/c21-16-11-14(5-6-19(24)25)12-17(22)20(16)27-13-15-3-1-2-4-18(15)23-7-9-26-10-8-23/h1-4,11-12H,5-10,13H2,(H,24,25).
What are the key properties of 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid?
3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid has a molecular weight of 377.39 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-difluoro-4-[(2-morpholin-4-ylphenyl)methoxy]phenyl]propanoic acid is sourced from PubChem (CID 23136500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).