About 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid
3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid (PubChem CID 23136539) has the molecular formula C21H23F2NO3
and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid |
| PubChem CID | 23136539 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cc(F)c(OCc2ccccc2N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C21H23F2NO3/c22-17-12-15(8-9-20(25)26)13-18(23)21(17)27-14-16-6-2-3-7-19(16)24-10-4-1-5-11-24/h2-3,6-7,12-13H,1,4-5,8-11,14H2,(H,25,26) |
| InChIKey | ZJMNQIFUZMEYDI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid?
The IUPAC name of 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid (CID 23136539) is 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid is O=C(O)CCc1cc(F)c(OCc2ccccc2N2CCCCC2)c(F)c1.
What is the InChIKey of 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid?
The InChIKey is ZJMNQIFUZMEYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F2NO3/c22-17-12-15(8-9-20(25)26)13-18(23)21(17)27-14-16-6-2-3-7-19(16)24-10-4-1-5-11-24/h2-3,6-7,12-13H,1,4-5,8-11,14H2,(H,25,26).
What are the key properties of 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid?
3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid has a molecular weight of 375.42 g/mol, XLogP of 4.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-difluoro-4-[(2-piperidin-1-ylphenyl)methoxy]phenyl]propanoic acid is sourced from PubChem (CID 23136539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).