About calcium;tetraphenylboranuide;iodide
calcium;tetraphenylboranuide;iodide (PubChem CID 23136649) has the molecular formula C24H20BCaI
and a molecular weight of 486.22 g/mol. Its IUPAC name is calcium;tetraphenylboranuide;iodide.
Molecular Properties
| Compound Name | calcium;tetraphenylboranuide;iodide |
| PubChem CID | 23136649 |
| Molecular Formula | C24H20BCaI |
| Molecular Weight | 486.22 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | calcium;tetraphenylboranuide;iodide |
| SMILES | [Ca+2].[I-].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.Ca.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;;/h1-20H;;1H/q-1;+2;/p-1 |
| InChIKey | UUGFSHVPKWMOPZ-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze calcium;tetraphenylboranuide;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;tetraphenylboranuide;iodide?
The IUPAC name of calcium;tetraphenylboranuide;iodide (CID 23136649) is calcium;tetraphenylboranuide;iodide.
What is the SMILES notation for calcium;tetraphenylboranuide;iodide?
The canonical SMILES for calcium;tetraphenylboranuide;iodide is [Ca+2].[I-].c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of calcium;tetraphenylboranuide;iodide?
The InChIKey is UUGFSHVPKWMOPZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H20B.Ca.HI/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;;/h1-20H;;1H/q-1;+2;/p-1.
What are the key properties of calcium;tetraphenylboranuide;iodide?
calcium;tetraphenylboranuide;iodide has a molecular weight of 486.22 g/mol, XLogP of -0.31, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;tetraphenylboranuide;iodide is sourced from PubChem (CID 23136649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).