About tricyclopentylphosphane;hydrochloride
tricyclopentylphosphane;hydrochloride (PubChem CID 23136677) has the molecular formula C15H28ClP
and a molecular weight of 274.82 g/mol. Its IUPAC name is tricyclopentylphosphane;hydrochloride.
Molecular Properties
| Compound Name | tricyclopentylphosphane;hydrochloride |
| PubChem CID | 23136677 |
| Molecular Formula | C15H28ClP |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | tricyclopentylphosphane;hydrochloride |
| SMILES | C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl |
| InChI | InChI=1S/C15H27P.ClH/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;/h13-15H,1-12H2;1H |
| InChIKey | HKEQYGCWGBOPTJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tricyclopentylphosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclopentylphosphane;hydrochloride?
The IUPAC name of tricyclopentylphosphane;hydrochloride (CID 23136677) is tricyclopentylphosphane;hydrochloride.
What is the SMILES notation for tricyclopentylphosphane;hydrochloride?
The canonical SMILES for tricyclopentylphosphane;hydrochloride is C1CCC(P(C2CCCC2)C2CCCC2)C1.Cl.
What is the InChIKey of tricyclopentylphosphane;hydrochloride?
The InChIKey is HKEQYGCWGBOPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27P.ClH/c1-2-8-13(7-1)16(14-9-3-4-10-14)15-11-5-6-12-15;/h13-15H,1-12H2;1H.
What are the key properties of tricyclopentylphosphane;hydrochloride?
tricyclopentylphosphane;hydrochloride has a molecular weight of 274.82 g/mol, XLogP of 5.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclopentylphosphane;hydrochloride is sourced from PubChem (CID 23136677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).