About 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline
4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline (PubChem CID 23137212) has the molecular formula C15H13ClF6N2O
and a molecular weight of 386.72 g/mol. Its IUPAC name is 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline |
| PubChem CID | 23137212 |
| Molecular Formula | C15H13ClF6N2O |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline |
| SMILES | COc1ccc(C(F)(F)F)cc1N.Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H8F3NO.C7H5ClF3N/c1-13-7-3-2-5(4-6(7)12)8(9,10)11;8-6-2-1-4(12)3-5(6)7(9,10)11/h2-4H,12H2,1H3;1-3H,12H2 |
| InChIKey | YWKRKMMLZHOGMB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline?
The IUPAC name of 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline (CID 23137212) is 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline.
What is the SMILES notation for 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline?
The canonical SMILES for 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline is COc1ccc(C(F)(F)F)cc1N.Nc1ccc(Cl)c(C(F)(F)F)c1.
What is the InChIKey of 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline?
The InChIKey is YWKRKMMLZHOGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO.C7H5ClF3N/c1-13-7-3-2-5(4-6(7)12)8(9,10)11;8-6-2-1-4(12)3-5(6)7(9,10)11/h2-4H,12H2,1H3;1-3H,12H2.
What are the key properties of 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline?
4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline has a molecular weight of 386.72 g/mol, XLogP of 5.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(trifluoromethyl)aniline;2-methoxy-5-(trifluoromethyl)aniline is sourced from PubChem (CID 23137212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).