About 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one (PubChem CID 23137502) has the molecular formula C40H36N4O4S2
and a molecular weight of 700.89 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
| PubChem CID | 23137502 |
| Molecular Formula | C40H36N4O4S2 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.CCN(CC)c1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/2C20H18N2O2S/c2*1-3-22(4-2)14-10-9-13-11-15(20(23)24-17(13)12-14)19-21-16-7-5-6-8-18(16)25-19/h2*5-12H,3-4H2,1-2H3 |
| InChIKey | MWZIIFSEOZGBIM-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 92.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one?
The IUPAC name of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one (CID 23137502) is 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one.
What is the SMILES notation for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one?
The canonical SMILES for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one is CCN(CC)c1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.CCN(CC)c1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.
What is the InChIKey of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one?
The InChIKey is MWZIIFSEOZGBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H18N2O2S/c2*1-3-22(4-2)14-10-9-13-11-15(20(23)24-17(13)12-14)19-21-16-7-5-6-8-18(16)25-19/h2*5-12H,3-4H2,1-2H3.
What are the key properties of 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one?
3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one has a molecular weight of 700.89 g/mol, XLogP of 9.83, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-yl)-7-(diethylamino)chromen-2-one is sourced from PubChem (CID 23137502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).