C12H8N2O2 — CID 23137795
4a,9-dihydro-3,8-phenanthroline-2,5-dione (PubChem CID 23137795) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4a,9-dihydro-3,8-phenanthroline-2,5-dione.
| Compound Name | 4a,9-dihydro-3,8-phenanthroline-2,5-dione |
|---|---|
| PubChem CID | 23137795 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4a,9-dihydro-3,8-phenanthroline-2,5-dione |
| SMILES | O=C1C=C2C3=CCN=CC3=CC(=O)C2C=N1 |
| InChI | InChI=1S/C12H8N2O2/c15-11-3-7-5-13-2-1-8(7)9-4-12(16)14-6-10(9)11/h1,3-6,10H,2H2 |
| InChIKey | WXIZPEURGPFLHA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |