C16H11BrN2O4 — CID 2313865
(E)-3-(5-bromofuran-2-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide (PubChem CID 2313865) has the molecular formula C16H11BrN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2313865 |
| Molecular Formula | C16H11BrN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)/C=C/c3ccc(Br)o3)cc2C1=O |
| InChI | InChI=1S/C16H11BrN2O4/c1-19-15(21)11-5-2-9(8-12(11)16(19)22)18-14(20)7-4-10-3-6-13(17)23-10/h2-8H,1H3,(H,18,20)/b7-4+ |
| InChIKey | WZUDLPWLSVZYLX-QPJJXVBHSA-N |
| XLogP | 2.92 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|