C30H30N4O3 — CID 23138651
methyl 2-[5-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazol-1-yl]acetate (PubChem CID 23138651) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is methyl 2-[5-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazol-1-yl]acetate.
| Compound Name | methyl 2-[5-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazol-1-yl]acetate |
|---|---|
| PubChem CID | 23138651 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl 2-[5-[(E)-(4-hydroxy-1-tritylpiperidin-3-ylidene)methyl]-1,2,4-triazol-1-yl]acetate |
| SMILES | COC(=O)Cn1ncnc1/C=C1\CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCC1O |
| InChI | InChI=1S/C30H30N4O3/c1-37-29(36)21-34-28(31-22-32-34)19-23-20-33(18-17-27(23)35)30(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-16,19,22,27,35H,17-18,20-21H2,1H3/b23-19+ |
| InChIKey | HRPGOHMBRJXHJT-FCDQGJHFSA-N |
| XLogP | 3.89 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|