About S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride
S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride (PubChem CID 23138696) has the molecular formula C11H15ClN2OS2
and a molecular weight of 290.84 g/mol. Its IUPAC name is S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride.
Molecular Properties
| Compound Name | S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
| PubChem CID | 23138696 |
| Molecular Formula | C11H15ClN2OS2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride |
| SMILES | CC(=O)SC1CCNC/C1=C/c1cncs1.Cl |
| InChI | InChI=1S/C11H14N2OS2.ClH/c1-8(14)16-11-2-3-12-5-9(11)4-10-6-13-7-15-10;/h4,6-7,11-12H,2-3,5H2,1H3;1H/b9-4-; |
| InChIKey | FZSZTFRAKVSELI-WONROIIJSA-N |
| XLogP | 2.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride?
The IUPAC name of S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride (CID 23138696) is S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride.
What is the SMILES notation for S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride?
The canonical SMILES for S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride is CC(=O)SC1CCNC/C1=C/c1cncs1.Cl.
What is the InChIKey of S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride?
The InChIKey is FZSZTFRAKVSELI-WONROIIJSA-N. The full InChI is InChI=1S/C11H14N2OS2.ClH/c1-8(14)16-11-2-3-12-5-9(11)4-10-6-13-7-15-10;/h4,6-7,11-12H,2-3,5H2,1H3;1H/b9-4-;.
What are the key properties of S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride?
S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride has a molecular weight of 290.84 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3Z)-3-(1,3-thiazol-5-ylmethylidene)piperidin-4-yl] ethanethioate;hydrochloride is sourced from PubChem (CID 23138696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).