About ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate
ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate (PubChem CID 23138843) has the molecular formula C14H26O5Si
and a molecular weight of 302.44 g/mol. Its IUPAC name is ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate.
Molecular Properties
| Compound Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate |
| PubChem CID | 23138843 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate |
| SMILES | CCOC(=O)CC(=O)CC(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O5Si/c1-7-18-13(17)9-11(15)8-12(16)10-19-20(5,6)14(2,3)4/h7-10H2,1-6H3 |
| InChIKey | KEBDRABUIKVDPG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate?
The IUPAC name of ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate (CID 23138843) is ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate.
What is the SMILES notation for ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate?
The canonical SMILES for ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate is CCOC(=O)CC(=O)CC(=O)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate?
The InChIKey is KEBDRABUIKVDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5Si/c1-7-18-13(17)9-11(15)8-12(16)10-19-20(5,6)14(2,3)4/h7-10H2,1-6H3.
What are the key properties of ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate?
ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate has a molecular weight of 302.44 g/mol, XLogP of 2.49, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[tert-butyl(dimethyl)silyl]oxy-3,5-dioxohexanoate is sourced from PubChem (CID 23138843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).